IC Chips

74 series Digital Integrated Circuits

CD40 series Digital Integrated Circuits

Optical Couplers

Clock & Calculator ICs

Operational Amplifiers

Power Switch Ics

Driver Ics

Flash Memory


Audio Special Purpose

Clock/Timing - Application Specific

Clock/Timing - Clock Buffers, Drivers

Clock/Timing - Clock Generators, PLLs, Frequency Synthesizers

Clock/Timing - Delay Lines

Clock/Timing - IC Batteries

Clock/Timing - Programmable Timers and Oscillators

Clock/Timing - Real Time Clocks

Data Acquisition - ADCs/DACs - Special Purpose

Data Acquisition - Analog Front End (AFE)

Data Acquisition - Analog to Digital Converters (ADC)

Data Acquisition - Digital Potentiometers

Data Acquisition - Digital to Analog Converters (DAC)

Data Acquisition - Touch Screen Controllers

Embedded - CPLDs (Complex Programmable Logic Devices)

Embedded - DSP (Digital Signal Processors)

Embedded - FPGAs (Field Programmable Gate Array)

Embedded - FPGAs (Field Programmable Gate Array) with Microcontrollers

Embedded - Microcontroller, Microprocessor, FPGA Modules

Embedded - Microcontrollers

Embedded - Microcontrollers - Application Specific

Embedded - Microprocessors

Embedded - PLDs (Programmable Logic Device)

Embedded - System On Chip (SoC)

Interface - Analog Switches - Special Purpose

Interface - Analog Switches, Multiplexers, Demultiplexers

Interface - CODECs

Interface - Controllers

Interface - Direct Digital Synthesis (DDS)

Interface - Drivers, Receivers, Transceivers

Interface - Encoders, Decoders, Converters

Interface - Filters - Active

Interface - I/O Expanders

Interface - Modems - ICs and Modules

Interface - Modules

Interface - Sensor and Detector Interfaces

Interface - Sensor, Capacitive Touch

Interface - Serializers, Deserializers

Interface - Signal Buffers, Repeaters, Splitters

Interface - Signal Terminators

Interface - Specialized

Interface - Telecom

Interface - UARTs (Universal Asynchronous Receiver Transmitter)

Interface - Voice Record and Playback

Linear - Amplifiers - Audio

Linear - Amplifiers - Instrumentation, OP Amps, Buffer Amps

Linear - Amplifiers - Special Purpose

Linear - Amplifiers - Video Amps and Modules

Linear - Analog Multipliers, Dividers

Linear - Comparators

Linear - Video Processing

Logic - Buffers, Drivers, Receivers, Transceivers

Logic - Comparators

Logic - Counters, Dividers

Logic - FIFOs Memory

Logic - Flip Flops

Logic - Gates and Inverters

Logic - Gates and Inverters - Multi-Function, Configurable

Logic - Latches

Logic - Multivibrators

Logic - Parity Generators and Checkers

Logic - Shift Registers

Logic - Signal Switches, Multiplexers, Decoders

Logic - Specialty Logic

Logic - Translators, Level Shifters

Logic - Universal Bus Functions

Memory - Batteries

Memory - Configuration Proms for FPGAs

Memory - Controllers

PMIC - AC DC Converters, Offline Switchers

PMIC - Battery Chargers

PMIC - Battery Management

PMIC - Current Regulation/Management

PMIC - Display Drivers

PMIC - Energy Metering

PMIC - Full, Half-Bridge Drivers

PMIC - Gate Drivers

PMIC - Hot Swap Controllers

PMIC - Laser Drivers

PMIC - LED Drivers

PMIC - Lighting, Ballast Controllers

PMIC - Motor Drivers, Controllers

PMIC - OR Controllers, Ideal Diodes

PMIC - PFC (Power Factor Correction)

PMIC - Power Distribution Switches, Load Drivers

PMIC - Power Management - Specialized

PMIC - Power Over Ethernet (PoE) Controllers

PMIC - Power Supply Controllers, Monitors

PMIC - RMS to DC Converters

PMIC - Supervisors

PMIC - Thermal Management

PMIC - V/F and F/V Converters

PMIC - Voltage Reference

PMIC - Voltage Regulators - DC DC Switching Controllers

PMIC - Voltage Regulators - DC DC Switching Regulators

PMIC - Voltage Regulators - Linear

PMIC - Voltage Regulators - Linear + Switching

PMIC - Voltage Regulators - Linear Regulator Controllers

PMIC - Voltage Regulators - Special Purpose

Specialized ICs






Power Supply

Smart Power Module

SCR,GTO and Diode


Darlington Transistors

RF Modules




Servo drive & amplifier & Servo

Diode Module

Transistor Module

Switch Relay



Contactor & Breaker

Elevator Board

Industry Control



Bipolar transistors


Carbon Film Resistors

Cement Resistors

Chassis Mount Resistors

Chip Resistor - Surface Mount

Current Sense Resistors

Fusible Chip Resistor

High Precision & Low TCR SMD Resistors

High Voltage Resistor

LED Strip Resistors

MELF Resistor

Metal Alloy Resistors

Metal Film Resistor (TH)

Metal Glaze Resistors

Metal Oxide Film Resistors

Metal Oxide Resistors

NTC Thermistors

PTC Thermistors


Potentiometers & Variable Resistors

Precision Potentiometer

Resistor Networks & Arrays

Resistor Networks & Arrays (TH)

Ultra Low Resistors (SMD)

Variable Resistors


Wirewound Resistors


Aluminum Electrolytic Capacitors - SMD

CL21 Capacitor

Ceramic Disc Capacitors

High Voltage Capacitors

Metallized Polyester Film Capacitor

Multilayer Ceramic Capacitors MLCC - Leaded

Multilayer Ceramic Capacitors MLCC - SMD/SMT

Mylar Capacitor

Niobium Oxide Capacitors

Polyester Film Capacitors

Solid Polymer Electrolytic Capacitor

Supercapacitors & Ultracapacitors

Suppression Capacitors

Tantalum Capacitors

Trimmers, Variable Capacitors

Inductors & Ferrite Beads & Transformers


Current Transformers

General Inductors (TH)

HF Inductors

Inductors (SMD)

LINE Filter

Power Inductors

Power Transformer

RJ45 Transformer

Radial Inductor (TH)

The circular inductors





Ceramic Resonators

DIP Oscillators(XO)

Radial Cylinder Crystals

SAW Resonators

SMD Crystals

SMD Oscillators(XO)


AV Connectors

Audio & Video Connectors

Banana and Tip Connectors

Card Edge Connectors

Circular Connectors

Connector - Card Sockets


Connectors - Accessories

Connectors - Housings


D-Sub Connectors

Ethernet Connectors/Modular Connectors

FFC, FPC (Flat Flexible) Connectors

Fiber Optic Connectors

IC & Component Sockets

LED Light Pipes

Mezzanine Connectors (Board to Board)

PCB Connectors - Headers, Male Pins

PCB Connectors - Headers, Receptacles, Female Sockets

PCB Connectors - Housings

Power Connectors

RF Connectors/Coaxial Connectors

Shunts & Jumpers

Terminal Blocks - Accessories

Terminal Blocks - Barrier Blocks

Terminal Blocks - Din Rail, Channel

Terminal Blocks - Headers, Plugs and Sockets


Test Clips

Test Points/Test Rings

USB Connectors

Unspecified Connectors

Screw-type wiring

Spring-type wiring

Pluggable Terminal Blocks

Through-wall Terminal Blocks

Sign In

3.Enter "account center"->"My inquiries" and check the status of your inquiries

Dear customers, due to the implementation of the GDPR policy in Europe, UTSOURCE has also made adjustment accordingly to meet the policy requirements. Please read the new privacy policy carefully and this window will no longer pop up after you accept it.

I agree all UTSOURCE Terms & Conditions,Privacy Statement
Agree Later Submit

Express:(FEDEX, UPS, DHL, TNT)Free shipping on first 0.5kg for orders over 150$,Overweight will be charged separately

. More details, pls click
relate product result :437 items
Capacitance :


Lead Spacing :


Tolerance :


Voltage - Rated :


Part Number

Product Description Encapsulation / DateCode / Capacitance / Voltage Rating / Type


Price / PLUS price

STE(Songtian Elec) T14E1D472MN0B0S0N0



US $0.23268

US $0.21872


US $0.17568

US $0.16514


US $0.16524

US $0.15533


US $0.15480

US $0.14551


US $0.15012

US $0.14111


US $0.14784

US $0.13897

More: Inquiry



Hongzhi Elec Y25E1E102M(20pcs)



US $0.41760

US $0.39254


US $0.30720

US $0.28877


US $0.28800

US $0.27072


US $0.26640

US $0.25042


US $0.25920

US $0.24365


US $0.25440

US $0.23914

More: Inquiry



TDK CS13-E2GA332MYNSA(5pcs)



US $0.44700

US $0.42018


US $0.33720

US $0.31697


US $0.31740

US $0.29836


US $0.29700

US $0.27918


US $0.28860

US $0.27128


US $0.28380

US $0.26677

More: Inquiry



TDK CD70-B2GA221KYVKA(10pcs)



US $0.43320

US $0.40721


US $0.33360

US $0.31358


US $0.31440

US $0.29554


US $0.29640

US $0.27862


US $0.28800

US $0.27072


US $0.28440

US $0.26734

More: Inquiry



Dersonic CC1H120KA1PDCH4B3003(50pcs)



US $0.49200

US $0.46248


US $0.36600

US $0.34404


US $0.34200

US $0.32148


US $0.31800

US $0.29892


US $0.30600

US $0.28764


US $0.30000

US $0.28200

More: Inquiry



TDK CC45SL3FD220JYVNA(10pcs)



US $0.50880

US $0.47827


US $0.37800

US $0.35532


US $0.35280

US $0.33163


US $0.32880

US $0.30907


US $0.31800

US $0.29892


US $0.31320

US $0.29441

More: Inquiry



TDK CK45-B3AD471KYANA(20pcs)



US $0.50640

US $0.47602


US $0.38160

US $0.35870


US $0.36000

US $0.33840


US $0.33600

US $0.31584


US $0.32640

US $0.30682


US $0.32160

US $0.30230

More: Inquiry



TDK CK45-B3AD472KYANA(5pcs)



US $0.52500

US $0.49350


US $0.40380

US $0.37957


US $0.38160

US $0.35870


US $0.35880

US $0.33727


US $0.34920

US $0.32825


US $0.34440

US $0.32374

More: Inquiry



Dersonic CC1H104ZC1PD3F5P3003(50pcs)



US $0.62400

US $0.58656


US $0.46200

US $0.43428


US $0.43200

US $0.40608


US $0.39600

US $0.37224


US $0.38400

US $0.36096


US $0.37800

US $0.35532

More: Inquiry



TDK CK45-B3AD471KYVNA(20pcs)



US $0.59520

US $0.55949


US $0.45840

US $0.43090


US $0.43200

US $0.40608


US $0.40800

US $0.38352


US $0.39600

US $0.37224


US $0.39120

US $0.36773

More: Inquiry



TDK CD45-E2GA102M-NKA(10pcs)



US $0.66000

US $0.62040


US $0.49080

US $0.46135


US $0.45960

US $0.43202


US $0.42840

US $0.40269


US $0.41520

US $0.39029


US $0.40800

US $0.38352

More: Inquiry



TDK CK45-R3AD221K-VRA(10pcs)



US $0.62880

US $0.59107


US $0.48360

US $0.45458


US $0.45720

US $0.42977


US $0.43080

US $0.40495


US $0.41880

US $0.39367


US $0.41280

US $0.38803

More: Inquiry



TDK CS95ZU2GA332MYAKA(10pcs)



US $0.63120

US $0.59333


US $0.48600

US $0.45684


US $0.45840

US $0.43090


US $0.43200

US $0.40608


US $0.42000

US $0.39480


US $0.41400

US $0.38916

More: Inquiry



TDK CK45-B3FD681KYVNA(10pcs)



US $0.69360

US $0.65198


US $0.52320

US $0.49181


US $0.49200

US $0.46248


US $0.46080

US $0.43315


US $0.44640

US $0.41962


US $0.44040

US $0.41398

More: Inquiry



TDK CS65-B2GA221KYGKA(20pcs)



US $0.74160

US $0.69710


US $0.54240

US $0.50986


US $0.50400

US $0.47376


US $0.46800

US $0.43992


US $0.45120

US $0.42413


US $0.44400

US $0.41736

More: Inquiry



TDK CD70-B2GA101KYGKA(20pcs)



US $0.83520

US $0.78509


US $0.63600

US $0.59784


US $0.59760

US $0.56174


US $0.56160

US $0.52790


US $0.54480

US $0.51211


US $0.53760

US $0.50534

More: Inquiry



FH(Guangdong Fenghua Advanced Tech) CT1-L5Y5P5B102KTPW(50pcs)



US $0.92400

US $0.86856


US $0.68400

US $0.64296


US $0.64200

US $0.60348


US $0.60000

US $0.56400


US $0.58200

US $0.54708


US $0.57000

US $0.53580

More: Inquiry



2KV821 high voltage ceramic capacitor 2KV 821K 820PF 2000V 10%




US $0.06372

US $0.05990


US $0.04248

US $0.03993


US $0.02124

US $0.01997


US $0.01912

US $0.01797

More: Inquiry



No matching goods? Inquiry here.
Alternate Text


Alternate Text Alternate Text Alternate Text

Product New Used

Stop production experts, we can provide a large number of electronic components that have been stopped production and are difficult to find, to facilitate the maintenance company

Alternate Text Stock




Global logistics

Copyright © 2020 Power by UTSOURCE HOLDING COMPANY LIMITED ISO/IEC 20000-1:2011,ISO/IEC 27001:2013