IC Chips

74 series Digital Integrated Circuits

CD40 series Digital Integrated Circuits

Optical Couplers

Clock & Calculator ICs

Operational Amplifiers

Power Switch Ics

Driver Ics

Flash Memory

Memory

Audio Special Purpose

Clock/Timing - Application Specific

Clock/Timing - Clock Buffers, Drivers

Clock/Timing - Clock Generators, PLLs, Frequency Synthesizers

Clock/Timing - Delay Lines

Clock/Timing - IC Batteries

Clock/Timing - Programmable Timers and Oscillators

Clock/Timing - Real Time Clocks

Data Acquisition - ADCs/DACs - Special Purpose

Data Acquisition - Analog Front End (AFE)

Data Acquisition - Analog to Digital Converters (ADC)

Data Acquisition - Digital Potentiometers

Data Acquisition - Digital to Analog Converters (DAC)

Data Acquisition - Touch Screen Controllers

Embedded - CPLDs (Complex Programmable Logic Devices)

Embedded - DSP (Digital Signal Processors)

Embedded - FPGAs (Field Programmable Gate Array)

Embedded - FPGAs (Field Programmable Gate Array) with Microcontrollers

Embedded - Microcontroller, Microprocessor, FPGA Modules

Embedded - Microcontrollers

Embedded - Microcontrollers - Application Specific

Embedded - Microprocessors

Embedded - PLDs (Programmable Logic Device)

Embedded - System On Chip (SoC)

Interface - Analog Switches - Special Purpose

Interface - Analog Switches, Multiplexers, Demultiplexers

Interface - CODECs

Interface - Controllers

Interface - Direct Digital Synthesis (DDS)

Interface - Drivers, Receivers, Transceivers

Interface - Encoders, Decoders, Converters

Interface - Filters - Active

Interface - I/O Expanders

Interface - Modems - ICs and Modules

Interface - Modules

Interface - Sensor and Detector Interfaces

Interface - Sensor, Capacitive Touch

Interface - Serializers, Deserializers

Interface - Signal Buffers, Repeaters, Splitters

Interface - Signal Terminators

Interface - Specialized

Interface - Telecom

Interface - UARTs (Universal Asynchronous Receiver Transmitter)

Interface - Voice Record and Playback

Linear - Amplifiers - Audio

Linear - Amplifiers - Instrumentation, OP Amps, Buffer Amps

Linear - Amplifiers - Special Purpose

Linear - Amplifiers - Video Amps and Modules

Linear - Analog Multipliers, Dividers

Linear - Comparators

Linear - Video Processing

Logic - Buffers, Drivers, Receivers, Transceivers

Logic - Comparators

Logic - Counters, Dividers

Logic - FIFOs Memory

Logic - Flip Flops

Logic - Gates and Inverters

Logic - Gates and Inverters - Multi-Function, Configurable

Logic - Latches

Logic - Multivibrators

Logic - Parity Generators and Checkers

Logic - Shift Registers

Logic - Signal Switches, Multiplexers, Decoders

Logic - Specialty Logic

Logic - Translators, Level Shifters

Logic - Universal Bus Functions

Memory - Batteries

Memory - Configuration Proms for FPGAs

Memory - Controllers

PMIC - AC DC Converters, Offline Switchers

PMIC - Battery Chargers

PMIC - Battery Management

PMIC - Current Regulation/Management

PMIC - Display Drivers

PMIC - Energy Metering

PMIC - Full, Half-Bridge Drivers

PMIC - Gate Drivers

PMIC - Hot Swap Controllers

PMIC - Laser Drivers

PMIC - LED Drivers

PMIC - Lighting, Ballast Controllers

PMIC - Motor Drivers, Controllers

PMIC - OR Controllers, Ideal Diodes

PMIC - PFC (Power Factor Correction)

PMIC - Power Distribution Switches, Load Drivers

PMIC - Power Management - Specialized

PMIC - Power Over Ethernet (PoE) Controllers

PMIC - Power Supply Controllers, Monitors

PMIC - RMS to DC Converters

PMIC - Supervisors

PMIC - Thermal Management

PMIC - V/F and F/V Converters

PMIC - Voltage Reference

PMIC - Voltage Regulators - DC DC Switching Controllers

PMIC - Voltage Regulators - DC DC Switching Regulators

PMIC - Voltage Regulators - Linear

PMIC - Voltage Regulators - Linear + Switching

PMIC - Voltage Regulators - Linear Regulator Controllers

PMIC - Voltage Regulators - Special Purpose

Specialized ICs

Modules

IGBT

IPM

Thyristors

Rectifiers

Power Supply

Smart Power Module

SCR,GTO and Diode

FET

Darlington Transistors

RF Modules

CNC PRODUCTS

ENCODER

Motor

Servo drive & amplifier & Servo

Diode Module

Transistor Module

Switch Relay

PLC

Inverter

Contactor & Breaker

Elevator Board

Industry Control

Transistors

Diode

Bipolar transistors

Resistors

Carbon Film Resistors

Cement Resistors

Chassis Mount Resistors

Chip Resistor - Surface Mount

Current Sense Resistors

Fusible Chip Resistor

High Precision & Low TCR SMD Resistors

High Voltage Resistor

LED Strip Resistors

MELF Resistor

Metal Alloy Resistors

Metal Film Resistor (TH)

Metal Glaze Resistors

Metal Oxide Film Resistors

Metal Oxide Resistors

NTC Thermistors

PTC Thermistors

Photoresistors

Potentiometers & Variable Resistors

Precision Potentiometer

Resistor Networks & Arrays

Resistor Networks & Arrays (TH)

Ultra Low Resistors (SMD)

Variable Resistors

Varistors

Wirewound Resistors

Capacitors

Aluminum Electrolytic Capacitors - SMD

CL21 Capacitor

Ceramic Disc Capacitors

High Voltage Capacitors

Metallized Polyester Film Capacitor

Multilayer Ceramic Capacitors MLCC - Leaded

Multilayer Ceramic Capacitors MLCC - SMD/SMT

Mylar Capacitor

Niobium Oxide Capacitors

Polyester Film Capacitors

Solid Polymer Electrolytic Capacitor

Supercapacitors & Ultracapacitors

Suppression Capacitors

Tantalum Capacitors

Trimmers, Variable Capacitors

Inductors & Ferrite Beads & Transformers

Antennas

Current Transformers

General Inductors (TH)

HF Inductors

Inductors (SMD)

LINE Filter

Power Inductors

Power Transformer

RJ45 Transformer

Radial Inductor (TH)

The circular inductors

Crystals

49S

49SMD

49U

Ceramic Resonators

DIP Oscillators(XO)

Radial Cylinder Crystals

SAW Resonators

SMD Crystals

SMD Oscillators(XO)

Connectors

AV Connectors

Audio & Video Connectors

Banana and Tip Connectors

Card Edge Connectors

Circular Connectors

Connector - Card Sockets

Connectors

Connectors - Accessories

Connectors - Housings

Contacts

D-Sub Connectors

Ethernet Connectors/Modular Connectors

FFC, FPC (Flat Flexible) Connectors

Fiber Optic Connectors

IC & Component Sockets

LED Light Pipes

Mezzanine Connectors (Board to Board)

PCB Connectors - Headers, Male Pins

PCB Connectors - Headers, Receptacles, Female Sockets

PCB Connectors - Housings

Power Connectors

RF Connectors/Coaxial Connectors

Shunts & Jumpers

Terminal Blocks - Accessories

Terminal Blocks - Barrier Blocks

Terminal Blocks - Din Rail, Channel

Terminal Blocks - Headers, Plugs and Sockets

Terminals

Test Clips

Test Points/Test Rings

USB Connectors

Unspecified Connectors

Screw-type wiring

Spring-type wiring

Pluggable Terminal Blocks

Through-wall Terminal Blocks

Sign In

3.Enter "account center"->"My inquiries" and check the status of your inquiries

Dear customers, due to the implementation of the GDPR policy in Europe, UTSOURCE has also made adjustment accordingly to meet the policy requirements. Please read the new privacy policy carefully and this window will no longer pop up after you accept it.

I agree all UTSOURCE Terms & Conditions,Privacy Statement
Agree Later Submit

Search results filter:

Home > Passive-components > Connectors > Contacts

Express:(FEDEX, UPS, DHL, TNT)Free shipping on first 0.5kg for orders over 150$,Overweight will be charged separately

. More details, pls click
relate product result :512 items
Filters:
clear
Connector Type :

Clear

Part Number

Product Description Spacing / DateCode / Brand / Connector A

Description

Price / PLUS price

TE Connectivity 1744144-1(20pcs)

TE Connectivity

≥1:

US $0.60840

US $0.55224

≥10:

US $0.44200

US $0.40120

≥30:

US $0.41080

US $0.37288

≥100:

US $0.37960

US $0.34456

≥500:

US $0.36660

US $0.33276

≥1000:

US $0.35880

US $0.32568

More: Inquiry

Stock:10840

Minimum:4

CJT(Changjiang Connectors) A1002-TP(100pcs)

Cjt(changjiang Connectors)

≥1:

US $0.79300

US $0.71980

≥10:

US $0.57200

US $0.51920

≥30:

US $0.53300

US $0.48380

≥100:

US $0.49400

US $0.44840

≥500:

US $0.48100

US $0.43660

≥1000:

US $0.46800

US $0.42480

More: Inquiry

Stock:29800

Minimum:3

JST Sales America SSH-003T-P0.2(100pcs)

Jst Sales America

≥1:

US $1.96300

US $1.78180

≥10:

US $1.43000

US $1.29800

≥30:

US $1.32600

US $1.20360

≥100:

US $1.23500

US $1.12100

≥500:

US $1.18300

US $1.07380

≥1000:

US $1.17000

US $1.06200

More: Inquiry

Stock:197200

Minimum:2

JST Sales America SIN-21T-1.8S(100pcs)

Jst Sales America

≥1:

US $2.14500

US $1.94700

≥10:

US $1.56000

US $1.41600

≥30:

US $1.44300

US $1.30980

≥100:

US $1.33900

US $1.21540

≥500:

US $1.28700

US $1.16820

≥1000:

US $1.27400

US $1.15640

More: Inquiry

Stock:6400

Minimum:2

TE Connectivity 177914-1(100pcs)

TE Connectivity

≥1:

US $2.82100

US $2.56060

≥10:

US $2.05400

US $1.86440

≥30:

US $1.91100

US $1.73460

≥100:

US $1.76800

US $1.60480

≥500:

US $1.70300

US $1.54580

≥1000:

US $1.67700

US $1.52220

More: Inquiry

Stock:19600

Minimum:2

MOLEX 430300004(100pcs)

Molex

≥1:

US $2.92500

US $2.65500

≥10:

US $2.11900

US $1.92340

≥30:

US $1.97600

US $1.79360

≥100:

US $1.83300

US $1.66380

≥500:

US $1.76800

US $1.60480

≥1000:

US $1.72900

US $1.56940

More: Inquiry

Stock:178100

Minimum:2

TE Connectivity 175152-1(100pcs)

TE Connectivity

≥1:

US $3.54900

US $3.22140

≥10:

US $2.56100

US $2.32460

≥30:

US $2.37900

US $2.15940

≥100:

US $2.19700

US $1.99420

≥500:

US $2.11900

US $1.92340

≥1000:

US $2.08000

US $1.88800

More: Inquiry

Stock:2000

Minimum:2

TE Connectivity 61116-1(100pcs)

TE Connectivity

≥1:

US $3.77000

US $3.42200

≥10:

US $2.74300

US $2.48980

≥30:

US $2.54800

US $2.31280

≥100:

US $2.35300

US $2.13580

≥500:

US $2.27500

US $2.06500

≥1000:

US $2.23600

US $2.02960

More: Inquiry

Stock:1500

Minimum:1

KUM MT025-23230(100pcs)

KUM

≥1:

US $3.71800

US $3.37480

≥10:

US $2.73000

US $2.47800

≥30:

US $2.54800

US $2.31280

≥100:

US $2.36600

US $2.14760

≥500:

US $2.27500

US $2.06500

≥1000:

US $2.23600

US $2.02960

More: Inquiry

Stock:2500

Minimum:1

TE Connectivity 171631-1(100pcs)

TE Connectivity

≥1:

US $3.79600

US $3.44560

≥10:

US $2.76900

US $2.51340

≥30:

US $2.57400

US $2.33640

≥100:

US $2.37900

US $2.15940

≥500:

US $2.30100

US $2.08860

≥1000:

US $2.24900

US $2.04140

More: Inquiry

Stock:2100

Minimum:1

MOLEX 357470110(100pcs)

Molex

≥1:

US $4.04300

US $3.66980

≥10:

US $2.93800

US $2.66680

≥30:

US $2.73000

US $2.47800

≥100:

US $2.53500

US $2.30100

≥500:

US $2.44400

US $2.21840

≥1000:

US $2.39200

US $2.17120

More: Inquiry

Stock:4500

Minimum:1

TE Connectivity 1376348-1(100pcs)

TE Connectivity

≥1:

US $4.08200

US $3.70520

≥10:

US $2.96400

US $2.69040

≥30:

US $2.75600

US $2.50160

≥100:

US $2.54800

US $2.31280

≥500:

US $2.45700

US $2.23020

≥1000:

US $2.41800

US $2.19480

More: Inquiry

Stock:3300

Minimum:1

JST Sales America SWPT-001T-P025(100pcs)

Jst Sales America

≥1:

US $4.38100

US $3.97660

≥10:

US $3.19800

US $2.90280

≥30:

US $2.99000

US $2.71400

≥100:

US $2.76900

US $2.51340

≥500:

US $2.67800

US $2.43080

≥1000:

US $2.62600

US $2.38360

More: Inquiry

Stock:50800

Minimum:1

TE Connectivity 962885-1(100pcs)

TE Connectivity

≥1:

US $7.20200

US $6.53720

≥10:

US $5.23900

US $4.75540

≥30:

US $4.87500

US $4.42500

≥100:

US $4.51100

US $4.09460

≥500:

US $4.35500

US $3.95300

≥1000:

US $4.27700

US $3.88220

More: Inquiry

Stock:7700

Minimum:1

JST Sales America SVF-42T-P2.0(100pcs)

Jst Sales America

≥1:

US $7.48800

US $6.79680

≥10:

US $5.43400

US $4.93240

≥30:

US $5.05700

US $4.59020

≥100:

US $4.68000

US $4.24800

≥500:

US $4.51100

US $4.09460

≥1000:

US $4.42000

US $4.01200

More: Inquiry

Stock:1500

Minimum:1

TE Connectivity 638652-1(100pcs)

TE Connectivity

≥1:

US $8.32000

US $7.55200

≥10:

US $6.04500

US $5.48700

≥30:

US $5.62900

US $5.10940

≥100:

US $5.20000

US $4.72000

≥500:

US $5.01800

US $4.55480

≥1000:

US $4.92700

US $4.47220

More: Inquiry

Stock:3400

Minimum:1

JST Sales America SCPT-A021GF-0.5(SN)(100pcs)

Jst Sales America

≥1:

US $14.58600

US $13.23960

≥10:

US $10.59500

US $9.61700

≥30:

US $9.86700

US $8.95620

≥100:

US $9.12600

US $8.28360

≥500:

US $8.80100

US $7.98860

≥1000:

US $8.64500

US $7.84700

More: Inquiry

Stock:10000

Minimum:1

TE Connectivity 963904-1(100pcs)

TE Connectivity

≥1:

US $14.63800

US $13.28680

≥10:

US $10.63400

US $9.65240

≥30:

US $9.89300

US $8.97980

≥100:

US $9.15200

US $8.30720

≥500:

US $8.82700

US $8.01220

≥1000:

US $8.67100

US $7.87060

More: Inquiry

Stock:900

Minimum:1

No matching goods? Inquiry here.
Alternate Text

Currency:

Alternate Text Alternate Text Alternate Text

Product New Used

Stop production experts, we can provide a large number of electronic components that have been stopped production and are difficult to find, to facilitate the maintenance company

Alternate Text Stock

Non-Stock

Non-Stock

GLOBAL PAYMENTS

Global logistics

footShip
Copyright © 2020 Power by UTSOURCE HOLDING COMPANY LIMITED ISO/IEC 20000-1:2011,ISO/IEC 27001:2013